Catalog No. S682073 CAS No. 49851-31-2 M.F C11H13BrO M. Wt 241.12 g/mol Availability In Stock
* This item is exclusively intended for research purposes and is not designed for human therapeutic applications or veterinary use.
49851-31-2
2-Bromo-1-phenyl-pentan-1-one
2-bromo-1-phenylpentan-1-one
C11H13BrO
241.12 g/mol
InChI=1S/C11H13BrO/c1-2-6-10(12)11(13)9-7-4-3-5-8-9/h3-5,7-8,10H,2,6H2,1H3
XOQFMNXQYSTQPE-UHFFFAOYSA-N
CCCC(C(=O)C1=CC=CC=C1)Br
2-Bromo-1-phenylpentan-1-one; 2-Bromovalerophenone
2-Bromo-1-phenyl-pentan-1-one serves as a valuable reagent in organic synthesis due to its reactive bromine atom and carbonyl group. The bromine can be readily displaced by other nucleophiles, allowing for the formation of new carbon-carbon bonds. This property makes it a versatile building block for creating complex organic molecules.
Due to its unique structure and reactivity, 2-Bromo-1-phenyl-pentan-1-one can be a starting material for synthesizing various pharmaceuticals. By manipulating the molecule's functional groups, researchers can create novel drug candidates with desired properties.
Heterocyclic compounds are organic molecules containing atoms other than carbon in their rings. 2-Bromo-1-phenyl-pentan-1-one can be a useful building block for synthesizing various heterocyclic compounds, such as pyridines, pyrimidines, and thiophenes. These heterocycles are important scaffolds found in many pharmaceuticals and functional materials.
2-Bromo-1-phenyl-pentan-1-one is an organic compound characterized by the molecular formula C11H13BrO and a molecular weight of 241.12 g/mol. It appears as a bright yellow oily liquid with a boiling point of 94–96 °C at a pressure of 0.25 Torr and a density of approximately 1.310 g/cm³. This compound is also known by several synonyms, including 2-Bromovalerophenone and α-Bromovalerophenone.
2-Bromo-1-phenyl-pentan-1-one itself is not known to have any specific biological activity. Its primary function is as a chemical intermediate for the synthesis of other molecules with potential biological applications.
The primary chemical reaction involving 2-Bromo-1-phenyl-pentan-1-one is its formation through bromination of phenylpentanone using sodium bromide and hydrogen peroxide in the presence of hydrochloric acid. This reaction typically yields the compound with high purity (around 95%) and is monitored using thin-layer chromatography.
Additionally, 2-Bromo-1-phenyl-pentan-1-one can participate in various organic transformations due to its reactive bromine atom, making it useful as an intermediate in synthesizing other compounds.
The synthesis of 2-Bromo-1-phenyl-pentan-1-one can be achieved through the following method:
2-Bromo-1-phenyl-pentan-1-one has several applications:
Several compounds share structural similarities with 2-Bromo-1-phenyl-pentan-1-one. Here are some notable examples:
The uniqueness of 2-Bromo-1-phenyl-pentan-1-one lies in its specific bromine substitution pattern on the pentanone chain, which influences its reactivity and application in synthesizing complex organic molecules compared to its analogs.
3.7
Last modified: 08-15-2023
Inquiry Online
* Please note that we will only send quotations to valid professional email addresses.
